1246815-59-7
1246815-59-7
Chemical Structure
5-Methyl cytosine-13C,15N2 hydrochloride
Synonym(s): 5-Methylcytosine hydrochloride-13C,15N2
- CAS No.: 1246815-59-7
- Formula:C413CH8ClN15N2O
- Molecular Weight:164.57
InChIKey: ANWMULVRPAUPJT-KLDFHAJVSA-N
SMILES: O=C1[15N]=CC([13CH3])=C(N)[15NH]1.Cl
Biological Activity: 5-Methyl cytosine-13C,15N2 hydrochloride (5-Methylcytosine hydrochloride-13C,15N2) is the 13C- and 15N-labeled 5-Methylcytosine hydrochloride (HY-W008091A). 5-Methylcytosine hydrochloride plays a crucial role in regulating gene expression, facilitating genomic imprinting, and suppressing transposable elements, while also being intricately linked to translational fidelity and tRNA recognition.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Methyl cytosine-13C,15N2 hydrochloride | 99.31% | 5-Methyl cytosine-13C,15N2 hydrochloride (5-Methylcytosine hydrochloride-13C,15N2) is the 13C- and 15N-labeled 5-Methylcytosine hydrochloride (HY-W008091A). 5-Methylcytosine hydrochloride plays a crucial role in regulating gene expression, facilitating genomic imprinting, and suppressing transposable elements, while also being intricately linked to translational fidelity and tRNA recognition. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Methylcytosine hydrochloride | 99.57% | 5-Methylcytosine hydrochloride is a well-characterized DNA modification in prokaryotes and eukaryotes. 5-Methylcytosine hydrochloride forms symmetrical methylation on CpG dinucleotides in DNA, stabilizes tRNA/rRNA structure in RNA, and affects mRNA translation. 5-Methylcytosine hydrochloride can be oxidized to generate 5hmC, 5fC, and 5caC. 5-Methylcytosine hydrochloride can be used in epigenetics, developmental biology, and the study of diseases such as colorectal cancer and hepatocellular carcinoma. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
