1254054-60-8
Chemical Structure
N3-O2Oc-O2Oc-OH
- CAS No.: 1254054-60-8
- Formula:C12H22N4O7
- Molecular Weight:334.33
IUPAC Name: 17-azido-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic acid
InChIKey: JSDQHVBNBHLKOJ-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCC(NCCOCCOCC(O)=O)=O
Biological Activity: N3-O2Oc-O2Oc-OH is a click chemistry reagent containing an azide[1]. N3-O2Oc-O2Oc-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-O2Oc-O2Oc-OH | N3-O2Oc-O2Oc-OH is a click chemistry reagent containing an azide. N3-O2Oc-O2Oc-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||