1260586-88-6
Chemical Structure
Biotin-C5-Azide
Synonym(s): DecarboxyBiotin-N3
- CAS No.: 1260586-88-6
- Formula:C10H17N5OS
- Molecular Weight:255.34
IUPAC Name: 2-isopropyl-5-(methoxymethoxy)phenol
InChIKey: CSDCRNNAOYVBRW-CIUDSAMLSA-N
SMILES: [N-]=[N+]=NCCCCC[C@H]1[C@]2([H])[C@@](CS1)([H])NC(N2)=O
Biological Activity: Biotin-C5-Azide (DecarboxyBiotin-N3) is a biotin reagent and can be used to prepare biotinylated conjugates[1]. Biotin-C5-Azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Biotin-C5-Azide | 98.92% | Biotin-C5-Azide (DecarboxyBiotin-N3) is a biotin reagent and can be used to prepare biotinylated conjugates. Biotin-C5-Azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
