1263195-02-3
Chemical Structure
N-Acetyl Norgestimate-d6
- CAS No.: 1263195-02-3
- Formula:C25H27D6NO4
- Molecular Weight:417.57
IUPAC Name: (8R,9S,10R,13S,14S,17R,E)-3-(acetoxyimino)-13-ethyl-17-ethynyl-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl-2,2,4,6,6,10-d6 acetate
InChIKey: JWLHCJCKDYVRNJ-RWWDXLKWSA-N
SMILES: CC[C@@]12[C@](CC[C@]2(C#C)OC(C)=O)([H])[C@@]3([H])[C@]([C@]4([2H])C(C([2H])([2H])C3)=C([2H])/C(C([2H])([2H])C4)=N/OC(C)=O)([H])CC1
Biological Activity: N-Acetyl Norgestimate-d6 is the deuterium labeled N-Acetyl Norgestimate[1]. N-Acetyl Norgestimate-d6 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Acetyl Norgestimate-d6 | N-Acetyl Norgestimate-d6 is the deuterium labeled N-Acetyl Norgestimate. N-Acetyl Norgestimate-d6 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||