1309931-84-7
Chemical Structure
12β-Hydroxyganoderenic acid B
- CAS No.: 1309931-84-7
- Formula:C30H42O8
- Molecular Weight:530.65
SMILES: C[C@]12C3=C(C([C@H]([C@@]1([C@H](CC2=O)/C(C)=C/C(CC(C)C(O)=O)=O)C)O)=O)[C@@]4([C@@](C(C)([C@H](CC4)O)C)([H])C[C@@H]3O)C
Biological Activity: 12β-Hydroxyganoderenic acid B (Compound 15) is the triterpenoid compound that can be isolated from Ganoderma lucidum. Some triterpenoids isolated from Ganoderma species are reported to exhibits antitumor, antimicrobial, antiviral and anti-aging activities[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
12β-Hydroxyganoderenic acid B | 12β-Hydroxyganoderenic acid B (Compound 15) is the triterpenoid compound that can be isolated from Ganoderma lucidum. Some triterpenoids isolated from Ganoderma species are reported to exhibits antitumor, antimicrobial, antiviral and anti-aging activities. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||