132196-54-4
Chemical Structure
Chrodrimanin B
- CAS No.: 132196-54-4
- Formula:C27H32O8
- Molecular Weight:484.54
IUPAC Name: (1R,2R,7aR,8S,9aR,13aS,13bS)-5,8-dihydroxy-2,7a,10,10,13a-pentamethyl-4,11-dioxo-1,7a,8,9,9a,10,11,13a,13b,14-decahydro-2H,4H-benzo[a]pyrano[3,4-j]xanthen-1-yl acetate
InChIKey: DYQKBALSPZQWQD-FWEFFTEASA-N
SMILES: C[C@@]([C@@](C(C)1C)([H])C[C@@H]2O)(C=CC1=O)[C@@](CC3=C([C@H]([C@H]4C)OC(C)=O)C(C(O4)=O)=C5O)([H])[C@]2(OC3=C5)C
Biological Activity: Chrodrimanin B, a metabolite of a fungal, is a potent, non-open-channel-blocking antagonist on?B.?mori GABAR RDL with an IC50?of 1.13 nM. Chrodrimanin B attenuates the peak current amplitude of the GABA response of RDL with an IC50?of 1.66 nM.?Chrodrimanin B, a meroterpenoid, shows insecticidal activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chrodrimanin B | Chrodrimanin B, a metabolite of a fungal, is a potent, non-open-channel-blocking antagonist on?B.?mori GABAR RDL with an IC50?of 1.13 nM. Chrodrimanin B attenuates the peak current amplitude of the GABA response of RDL with an IC50?of 1.66 nM.?Chrodrimanin B, a meroterpenoid, shows insecticidal activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||