134857-03-7
134857-03-7
Chemical Structure
Illudin B
- CAS No.: 134857-03-7
- Formula:C15H22O5
- Molecular Weight:282.33
SMILES: C[C@]1(C2(CC2)[C@@](O)(C(C3=C1[C@H](C(C)([C@H]3O)C)O)=O)C)O
Biological Activity: Illudin B is a DNA-targeting cytotoxin that forms interstrand DNA crosslinks via covalent binding, disrupting DNA replication and transcription. Illudin B induces cell cycle arrest and apoptosis, showing toxicity against multiple tumor cells (e.g., leukemia, breast, lung cancer)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Illudin B | Illudin B is a DNA-targeting cytotoxin that forms interstrand DNA crosslinks via covalent binding, disrupting DNA replication and transcription. Illudin B induces cell cycle arrest and apoptosis, showing toxicity against multiple tumor cells (e.g., leukemia, breast, lung cancer). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
Keywords
