1349190-76-6
Chemical Structure
5-(Biotinamido)pentylazide
- CAS No.: 1349190-76-6
- Formula:C15H26N6O2S
- Molecular Weight:354.47
IUPAC Name: N-(5-azidopentyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamide
InChIKey: HGHJIFNOKMTXHY-OBJOEFQTSA-N
SMILES: O=C(NCCCCCN=[N+]=[N-])CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O
Biological Activity: 5-Biotinamidopentylazide is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. 5-(Biotinamido)pentylazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-(Biotinamido)pentylazide | 5-Biotinamidopentylazide is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. 5-(Biotinamido)pentylazide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
