1354521-95-1
Chemical Structure
m-PEG9-azide
- CAS No.: 1354521-95-1
- Formula:C19H39N3O9
- Molecular Weight:453.53
IUPAC Name: 28-azido-2,5,8,11,14,17,20,23,26-nonaoxaoctacosane
InChIKey: YOCDAGUIMZYXKK-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOC
Biological Activity: m-PEG9-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. m-PEG9-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
m-PEG9-azide | m-PEG9-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. m-PEG9-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||