139657-61-7
Chemical Structure
D-Lyxose-13C-4
- CAS No.: 139657-61-7
- Formula:C413CH10O5
- Molecular Weight:151.12
IUPAC Name: (2S,3S,4R)-2,3,4,5-tetrahydroxypentanal-5-13C
InChIKey: PYMYPHUHKUWMLA-IAAYJPMJSA-N
SMILES: O=C[C@H]([C@H]([C@@H]([13CH2]O)O)O)O
Biological Activity: D-Lyxose-13C-4 is the 13C labeled D-Lyxose. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose[1][2].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
D-Lyxose-13C-4 | D-Lyxose-13C-4 is the 13C labeled D-Lyxose. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
D-Lyxose (Standard) | ≥98% | D-Lyxose (Standard) is the analytical standard of D-Lyxose. This product is intended for research and analytical applications. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
D-Lyxose-13C-2 | D-Lyxose-13C-2 is the 13C labeled D-Lyxose. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
D-Lyxose-d | D-Lyxose-d is the deuterium labeled D-Lyxose. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
D-Lyxose-d-1 | D-Lyxose-d-1 is the deuterium labeled D-Lyxose. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
D-Lyxose-13C-3 | D-Lyxose-13C-3 is the 13C labeled D-Lyxose. D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose sugar with significant potential for drug synthesis. D-Lyxose can be used as a starting material for anti-tumor drugs such as alpha galactose ceramide immunostimulants. D-Lyxose can be used as a precursor for L-nucleoside analogs for the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars such as L-ribose. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
D-Lyxose | 98.0% | D-Lyxose is an endogenous metabolite. D-Lyxose is a rare pentose with significant potential for pharmaceutical synthesis. D-Lyxose serves as a starting material for antitumor agents (such as α-galactosylceramide-based immunostimulants). D-Lyxose acts as a precursor for L-nucleoside analogs used in the development of antiviral drugs. D-Lyxose can be used as a synthetic intermediate for other rare sugars (such as L-ribose). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Kwon HJ, et al. Substrate specificity of a recombinant D-lyxose isomerase from Providencia stuartii for monosaccharides. J Biosci Bioeng. 2010 Jul;110(1):26-31. [Content Brief]
- [2]. Cho EA, et al. Characterization of a novel D-lyxose isomerase from Cohnella laevoribosii RI-39 sp. nov. J Bacteriol. 2007 Mar;189(5):1655-63. [Content Brief]