1426173-90-1
Chemical Structure
Cefaclor-d5
- CAS No.: 1426173-90-1
- Formula:C15H9D5ClN3O4S
- Molecular Weight:372.84
IUPAC Name: (6R,7R)-7-((R)-2-amino-2-(phenyl-d5)acetamido)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
InChIKey: QYIYFLOTGYLRGG-IMLLATIOSA-N
SMILES: O=C1N2[C@@](SCC(Cl)=C2C(O)=O)([H])[C@@H]1NC([C@@H](C3=C([2H])C([2H])=C([2H])C([2H])=C3[2H])N)=O
Biological Activity: Cefaclor-d5 is the deuterium labeled Cefaclor. Cefaclor is an effective antibiotic agent, and specifically binds to penicillin-binding protein 3 (PBP 3)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cefaclor-d5 | Cefaclor-d5 is the deuterium labeled Cefaclor. Cefaclor is an effective antibiotic agent, and specifically binds to penicillin-binding protein 3 (PBP 3). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cefaclor (Standard) | ≥98% | Cefaclor (Standard) is the analytical standard of Cefaclor. This product is intended for research and analytical applications. Cefaclor is a well-absorbed orally active cephalosporin antibiotic. Cefaclor can specifically bind to specific for penicillin-binding protein 3 (PBP3). Cefaclor can be used for the research kinds of infections caused by bacteria, such as respiratory tract infections, bacterial bronchitis, pharyngitis and skin infections. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cefaclor | 98.51% | Cefaclor is a well-absorbed orally active cephalosporin antibiotic. Cefaclor can specifically bind to specific for penicillin-binding protein 3 (PBP3). Cefaclor can be used for the research of depression and kinds of infections caused by bacteria, such as respiratory tract infections, bacterial bronchitis, pharyngitis and skin infections. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||