143452-11-3
Chemical Structure
Oasomycin B
- CAS No.: 143452-11-3
- Formula:C61H104O22
- Molecular Weight:1189.47
InChIKey: QDNMAZUKNSYLDM-SXBBZPROSA-N
SMILES: OC[C@H]([C@H]([C@@H]([C@@H]1O)O)O)O[C@@H]1O[C@H]2/C=C([C@@H]([C@H](/C=C/[C@@H]([C@H](/C=C/CC[C@@H]([C@@H]([C@@H]([C@H](CC/C=C(C(O[C@](C/C=C/[C@H](C[C@@H](C[C@H]([C@@H]([C@@H]([C@H]([C@H](C[C@H](C[C@@H](C[C@H]2O)O)O)O)C)O)C)O)O)O)([H])[C@@H]([C@]3([H])OC(CC3)=O)C)=O)\C)C)O)C)O)C)O)C)O)\C
Biological Activity: Oasomycin B, a member of the desertomycin family, is a polyketide. Oasomycin B can be isolated from Streptomyces sp. Oasomycin B, lacking the positively charged amino moiety, has no significant antibacterial activity and fails to induce Orsellinic acid (HY-N3126) production in A. nidulans[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Oasomycin B | Oasomycin B, a member of the desertomycin family, is a polyketide. Oasomycin B can be isolated from Streptomyces sp. Oasomycin B, lacking the positively charged amino moiety, has no significant antibacterial activity and fails to induce Orsellinic acid (HY-N3126) production in A. nidulans. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||