1445723-73-8
Chemical Structure
DSPE-PEG(2000) Succinyl ammonium
- CAS No.: 1445723-73-8
- Formula:(C2H4O)nC48H91N2O13P.NH3
- Molecular Weight:2000 (Average)
SMILES: [H][C@@](COP(O)(OCCNC(OCCOCCN([H])C(CCC(O)=O)=O)=O)=O)(OC(CCCCCCCCCCCCCCCCC)=O)COC(CCCCCCCCCCCCCCCCC)=O.[n].N
Biological Activity: DSPE-PEG(2000) Succinyl ammonium is functionalized PEG lipid that can be used to synthesize lipid nanoparticles for drug delivery.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DSPE-PEG(2000) Succinyl ammonium | 98.0% | DSPE-PEG(2000) Succinyl ammonium is functionalized PEG lipid that can be used to synthesize lipid nanoparticles for drug delivery. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||