145927-74-8
Chemical Structure
Azido-PEG4-THP
- CAS No.: 145927-74-8
- Formula:C13H25N3O5
- Molecular Weight:303.35
IUPAC Name: 2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)tetrahydro-2H-pyran
InChIKey: OHGLMVYYEIWYEF-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOC1OCCCC1
Biological Activity: Azido-PEG4-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG4-THP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG4-THP | Azido-PEG4-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG4-THP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||