147859-80-1
147859-80-1
Chemical Structure
CA-074 methyl ester
Synonym(s): CA-074Me
- CAS No.: 147859-80-1
- Formula:C19H31N3O6
- Molecular Weight:397.47
IUPAC Name: methyl ((2S,3S)-3-(propylcarbamoyl)oxirane-2-carbonyl)-L-isoleucyl-L-prolinate
InChIKey: XGWSRLSPWIEMLQ-YTFOTSKYSA-N
SMILES: O=C([C@@H]1[C@@H](C(NCCC)=O)O1)N[C@]([C@@H](C)CC)([H])C(N(CCC2)[C@@H]2C(OC)=O)=O
Biological Activity: CA-074 methyl ester is a specific inhibitor of Cathepsin B, which has potent bioactivities such as neuroprotective, anti-cancer, and anti-inflamatory effects.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CA-074 methyl ester | 99.81% | CA-074 methyl ester is a specific inhibitor of Cathepsin B, which has potent bioactivities such as neuroprotective, anti-cancer, and anti-inflamatory effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
CA-074 methyl ester (Standard) | ≥98% | CA-074 methyl ester (Standard) is the analytical standard of CA-074 methyl ester (HY-100350). This product is intended for research and analytical applications. CA-074 methyl ester is a specific inhibitor of Cathepsin B, which has potent bioactivities such as neuroprotective, anti-cancer, and anti-inflamatory effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
