151923-85-2
Chemical Structure
Aplyronine B
- CAS No.: 151923-85-2
- Formula:C59H101N3O14
- Molecular Weight:1076.44
IUPAC Name: (3E,5E,8R,9S,10R,11R,14S,15E,18R,20R,21E,24S)-24-((2S,3S,4S,7R,8S,9R,10R,E)-9-acetoxy-7-((dimethylalanyl)oxy)-3-hydroxy-4,8,10-trimethyl-12-(N-methylformamido)dodec-11-en-2-yl)-8-hydroxy-14,20-dimethoxy-9,11,15,18-tetramethyl-2-oxooxacyclotetracosa-3,5,15
InChIKey: LBWIGLNHANBXDK-JQEXLIRHSA-N
SMILES: O=C(O[C@H]1[C@@H](C)[C@H](O)C/C=C/C=C/C(O[C@H]([C@@H](C)[C@@H](O)[C@@H](C)CC[C@@H](OC(C(N(C)C)C)=O)[C@H](C)[C@H](OC(C)=O)[C@H](C)/C=C/N(C=O)C)C/C=C/[C@H](OC)C[C@H](C)C/C=C(C)/[C@@H](OC)CC[C@H]1C)=O)[C@H](COC)N(C)C
Biological Activity: Aplyronine B is an active compound. Aplyronine B shows potent antitumor activity and has cytotoxicity against HeLa-S3 cells with an IC50 values of 2.9 nM. Aplyronine B can be used for the research of cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aplyronine B | Aplyronine B is an active compound. Aplyronine B shows potent antitumor activity and has cytotoxicity against HeLa-S3 cells with an IC50 values of 2.9 nM. Aplyronine B can be used for the research of cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
