159600-82-5
Chemical Structure
(p-Iodo-Phe7)-ACTH (4-10)
- CAS No.: 159600-82-5
- Formula:C44H58IN13O10S
- Molecular Weight:1087.98
InChIKey: JEHNDLZVGYWOAY-LXOXETEGSA-N
SMILES: IC(C=C1)=CC=C1C[C@H](NC([C@@H](NC([C@H](CCC(O)=O)NC([C@@H](N)CCSC)=O)=O)CC2=CN=CN2)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@H](C(NCC(O)=O)=O)CC3=CNC4=CC=CC=C34)=O)=O
Biological Activity: (p-Iodo-Phe7)-ACTH (4-10) is a adrenocorticotrophic hormone (ACTH) derivative, which is produced and secreted by the anterior pituitary gland. (p-Iodo-Phe7)-ACTH (4-10) serves as a melanocortin (MC) receptor antagonist and inhibits α-melanocyte-stimulating hormone (α-MSH)-induced excessive grooming behavior in rats[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(p-Iodo-Phe7)-ACTH (4-10) | (p-Iodo-Phe7)-ACTH (4-10) is a adrenocorticotrophic hormone (ACTH) derivative, which is produced and secreted by the anterior pituitary gland. (p-Iodo-Phe7)-ACTH (4-10) serves as a melanocortin (MC) receptor antagonist and inhibits α-melanocyte-stimulating hormone (α-MSH)-induced excessive grooming behavior in rats. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||