1609083-15-9
Chemical Structure
Azido-PEG4-beta-D-glucose
- CAS No.: 1609083-15-9
- Formula:C14H27N3O9
- Molecular Weight:381.38
IUPAC Name: (2R,3R,4S,5S,6R)-2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol
InChIKey: AJCOHNWPGBTGTQ-RKQHYHRCSA-N
SMILES: O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1OCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG4-beta-D-glucose is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG4-beta-D-glucose is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG4-beta-D-glucose | 99.86% | Azido-PEG4-beta-D-glucose is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG4-beta-D-glucose is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
