1620410-04-9
Chemical Structure
Boc-D-Lys(N3)-OH
- CAS. Nr.: 1620410-04-9
- Formula:C11H20N4O4
- Molecular Weight:272.30
IUPAC Name: N2-(tert-butoxycarbonyl)-N6-diazo-D-lysine
InChIKey: SKRPDWWWUARZIW-MRVPVSSYSA-N
SMILES: CC(C)(C)OC(N[C@@H](C(O)=O)CCCCN=[N+]=[N-])=O
Biological Activity: Boc-D-Lys(N3)-OH is a Boc-protected amino acid derivative, can be used as a click chemistry reagent and an intermediate for synthesis of linkers[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Boc-D-Lys(N3)-OH | Boc-D-Lys(N3)-OH is a Boc-protected amino acid derivative, can be used as a click chemistry reagent and an intermediate for synthesis of linkers. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords