1653964-70-5
Chemical Structure
Butenafine-d4
Synonym(s): KP363-d4
- CAS No.: 1653964-70-5
- Formula:C23H23D4N
- Molecular Weight:321.49
InChIKey: ABJKWBDEJIDSJZ-RZOBCMOLSA-N
SMILES: CN(C([2H])([2H])C1=CC=C(C=C1)C(C)(C)C)C([2H])([2H])C2=C3C=CC=CC3=CC=C2
Biological Activity: Butenafine-d4 (KP363-d4) is the deuterium labeled Butenafine (HY-114518). Butenafine (KP363) is a potent and broad spectrum benzylamine antifungal agent[1]. Butenafine inhibits fungal ergosterol biosynthesis at the point of squalene epoxidation, leading to a deficiency of the fungal cell membranes. Butenafine is effective against dermatophytes infections, such as ?tinea pedis, ?tinea cruris, tinea versicolor[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Butenafine-d4 | Butenafine-d4 (KP363-d4) is the deuterium labeled Butenafine (HY-114518). Butenafine (KP363) is a potent and broad spectrum benzylamine antifungal agent. Butenafine inhibits fungal ergosterol biosynthesis at the point of squalene epoxidation, leading to a deficiency of the fungal cell membranes. Butenafine is effective against dermatophytes infections, such as ?tinea pedis, ?tinea cruris, tinea versicolor. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Butenafine | Butenafine (KP363) is a potent and broad spectrum benzylamine antifungal agent. Butenafine inhibits fungal ergosterol biosynthesis at the point of squalene epoxidation, leading to a deficiency of the fungal cell membranes. Butenafine is effective against dermatophytes infections, such as tinea pedis, tinea cruris, tinea versicolor. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Katrina Kokjohn, et al. Evaluation of in vitro activity of ciclopirox olamine, butenafine HCl and econazole nitrate against dermatophytes, yeasts and bacteria.Int J Dermatol. 2003 Sep;42 Suppl 1:11-7. [Content Brief]
- [2]. Adriana Bezerra-Souza, et al. The antifungal compound butenafine eliminates promastigote and amastigote forms of Leishmania (Leishmania) amazonensis and Leishmania (Viannia) braziliensis. 2016 Dec;65(6 Pt A):702-707. [Content Brief]