166447-71-8
Chemical Structure
(E,E)-Farnesol-d6
Synonym(s): trans,trans-Farnesol-d6;(2E,6E)-Farnesol-d6
- CAS No.: 166447-71-8
- Formula:C15H20D6O
- Molecular Weight:228.40
IUPAC Name: sodium 3-(4-(2-hydroxy-3-((propan-2-yl-d7)amino)propoxy)phenyl)propanoate
InChIKey: CRDAMVZIKSXKFV-JPWGLETFSA-N
SMILES: OC/C=C(C)/CC/C=C(C)/CC/C=C(C([2H])([2H])[2H])/C([2H])([2H])[2H]
Biological Activity: (E,E)-Farnesol-d6 (trans,trans-Farnesol-d6) is deuterium labeled (E,E)-Farnesol (HY-Y0248). (E,E)-Farnesol (trans,trans-Farnesol) is a quorum-sensing molecule of Candida species. (E,E)-Farnesol can inhibit the growth, metabolism and biofilm formation of various Candida species, and affect their morphology and invasiveness[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(E,E)-Farnesol-d6 | 98.71% | (E,E)-Farnesol-d6 (trans,trans-Farnesol-d6) is deuterium labeled (E,E)-Farnesol (HY-Y0248). (E,E)-Farnesol (trans,trans-Farnesol) is a quorum-sensing molecule of Candida species. (E,E)-Farnesol can inhibit the growth, metabolism and biofilm formation of various Candida species, and affect their morphology and invasiveness. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(E,E)-Farnesol (Standard) | ≥98% | (E,E)-Farnesol (Standard) (trans,trans-Farnesol (Standard)) is the analytical standard of (E,E)-Farnesol (HY-Y0248). This product is intended for research and analytical applications. (E,E)-Farnesol (trans,trans-Farnesol) is a quorum-sensing molecule of Candida species. (E,E)-Farnesol can inhibit the growth, metabolism and biofilm formation of various Candida species, and affect their morphology and invasiveness. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(E,E)-Farnesol-13C3 | (E,E)-Farnesol-13C3 (trans,trans-Farnesol-13C3) is the 13C-labeled (E,?E)?-?Farnesol (HY-Y0248). (E, E)-Farnesol (trans,trans-Farnesol;(2E,6E)-Farnesol) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
(E,E)-Farnesol | 99.16% | (E,E)-Farnesol (trans,trans-Farnesol) is a quorum-sensing molecule of Candida species. (E,E)-Farnesol can inhibit the growth, metabolism and biofilm formation of various Candida species, and affect their morphology and invasiveness. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-217. [Content Brief]
- [2]. Cordeiro Rde A, et al. Farnesol inhibits in vitro growth of the Cryptococcus neoformans species complex with no significant changes in virulence-related exoenzymes. Vet Microbiol. 2012 Oct 12;159(3-4):375-80. [Content Brief]