1673590-09-4
Chemical Structure
Ac4GalNAl
- CAS No.: 1673590-09-4
- Formula:C19H25NO10
- Molecular Weight:427.40
IUPAC Name: (2S,3R,4R,5R,6R)-6-(acetoxymethyl)-3-(pent-4-ynamido)tetrahydro-2H-pyran-2,4,5-triyl triacetate
InChIKey: PODQGPKRSTUNAT-IQZDNPOKSA-N
SMILES: O=C(N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OC(C)=O)COC(C)=O)OC(C)=O)OC(C)=O)CCC#C
Biological Activity: Ac4GalNAl is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Ac4GalNAl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ac4GalNAl | 99.78% | Ac4GalNAl is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. Ac4GalNAl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||