167894-15-7
Chemical Structure
Xerophilusin B
- CAS No.: 167894-15-7
- Formula:C20H26O5
- Molecular Weight:346.42
IUPAC Name: (1S,4S,5S,8S,9S,9aR,13aR,14R)-8,9-dihydroxy-10,10-dimethyl-16-methylenedecahydro-1H,6aH,8H-1,5,8,4-(epipropane[1,1,1,3]tetrayl)oxocino[3,2-j]isochromen-15-one
InChIKey: ZKUQCTVJZQFAKY-PKBAEFOZSA-N
SMILES: O[C@]12[C@]34[C@]5([H])[C@@]6(C(O[C@@]3([H])[C@](CC5)([H])C(C4=O)=C)([H])O2)[C@](C(C)(CCC6)C)([H])[C@@H]1O
Biological Activity: Xerophilusin B, an anticancer agent isolated from Isodon xerophilus, exhibits antiproliferative effects on esophageal squamous cell carcinoma (ESCC) cell lines, induces G2/M cell cycle arrest, and mediates apoptosis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Xerophilusin B | Xerophilusin B, an anticancer agent isolated from Isodon xerophilus, exhibits antiproliferative effects on esophageal squamous cell carcinoma (ESCC) cell lines, induces G2/M cell cycle arrest, and mediates apoptosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||