1708948-28-0
Chemical Structure
NA-17
- CAS No.: 1708948-28-0
- Formula:C26H27N3O4
- Molecular Weight:445.51
InChIKey: ACOYDEZACFFCPN-UHFFFAOYSA-N
SMILES: O=C1C2=CC=CC3=C2C(C(N1CCC4=CC=C5OCOC5=C4)=O)=CC=C3NCCCN(C)C
Biological Activity: NA-17 is a naphthalimide compound with anti-tumor activity and lower toxicity to normal cells like HL-7702 and WI-38. NA-17 exhibits a p53-dependent selective inhibition in various NSCLC cells, inducing the accumulation of active p53 in the mitochondria and nuclei of NSCLC cells. NA-17 can cause cell cycle arrest in the G1 phase, leading to apoptosis and cell death[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NA-17 | NA-17 is a naphthalimide compound with anti-tumor activity and lower toxicity to normal cells like HL-7702 and WI-38. NA-17 exhibits a p53-dependent selective inhibition in various NSCLC cells, inducing the accumulation of active p53 in the mitochondria and nuclei of NSCLC cells. NA-17 can cause cell cycle arrest in the G1 phase, leading to apoptosis and cell death. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||