172531-37-2
Chemical Structure
N3-PEG3-CH2COOH
Synonym(s): PROTAC Linker 14
- CAS No.: 172531-37-2
- Formula:C8H15N3O5
- Molecular Weight:233.22
IUPAC Name: 2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)acetic acid
InChIKey: GIXBCECBLAEYKA-UHFFFAOYSA-N
SMILES: OC(COCCOCCOCCN=[N+]=[N-])=O
Biological Activity: N3-PEG3-CH2COOH (PROTAC Linker 14) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. N3-PEG3-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG3-CH2COOH | 99.84% | N3-PEG3-CH2COOH (PROTAC Linker 14) is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. N3-PEG3-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||