1782935-10-7
Chemical Structure
H-L-Orn(N3)-OH hydrochloride
- CAS No.: 1782935-10-7
- Formula:C5H11ClN4O2
- Molecular Weight:194.62
IUPAC Name: (S)-2-amino-5-azidopentanoic acid hydrochloride
InChIKey: HBDWAEAKFVAPSA-WCCKRBBISA-N
SMILES: [N-]=[N+]=NCCC[C@H](N)C(O)=O.Cl
Biological Activity: H-L-Orn(N3)-OH (hydrochloride) is a click chemistry reagent containing an azide group. H-L-Orn(N3)-OH (hydrochloride) can be used for the research of various biochemical[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
H-L-Orn(N3)-OH hydrochloride | H-L-Orn(N3)-OH (hydrochloride) is a click chemistry reagent containing an azide group. H-L-Orn(N3)-OH (hydrochloride) can be used for the research of various biochemical. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
