178422-14-5
Chemical Structure
m3227G(5)ppp(5')Am
- CAS No.: 178422-14-5
- Formula:C24H35N10O17P3
- Molecular Weight:828.51
InChIKey: ZHUQCORINHBCFN-FRZFILDFSA-N
SMILES: O=C1C2=C(N([C@H]3[C@H](O)[C@H](O)[C@@H](COP(OP(OP(OC[C@H]4O[C@@H](N(C=N5)C6=C5C(N)=NC=N6)[C@H](OC)[C@@H]4O)(O)=O)(O)=O)([O-])=O)O3)C=[N+]2C)NC(N(C)C)=N1
Biological Activity: m3227G(5)ppp(5')Am is a specific mRNA molecule structure, which is composed of a 3227-methylguanine (m3227G) cap, a triphosphate group and a 2'-O-methyladenosine. Am is a reversible modification located on the first coding nucleotide near the 5' cap of mRNA, that can affect the stability of mRNA[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
m3227G(5)ppp(5')Am | m3227G(5)ppp(5')Am is a specific mRNA molecule structure, which is composed of a 3227-methylguanine (m3227G) cap, a triphosphate group and a 2'-O-methyladenosine. Am is a reversible modification located on the first coding nucleotide near the 5' cap of mRNA, that can affect the stability of mRNA. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||