1803099-44-6
Chemical Structure
Cyanine7.5 carboxylic acid chloride
- CAS No.: 1803099-44-6
- Formula:C45H49ClN2O2
- Molecular Weight:685.34
IUPAC Name: 3-(5-carboxypentyl)-1,1-dimethyl-2-((E)-2-((E)-3-((E)-2-(1,1,3-trimethyl-1,3-dihydro-2H-benzo[e]indol-2-ylidene)ethylidene)cyclohex-1-en-1-yl)vinyl)-1H-benzo[e]indol-3-ium chloride
InChIKey: NENPZWGBKUDTPW-UHFFFAOYSA-N
SMILES: O=C(CCCCC[N+]1=C(/C=C/C2=C/C(CCC2)=C/C=C3N(C)C4=C(C/3(C)C)C5=C(C=CC=C5)C=C4)C(C)(C)C6=C1C=CC7=C6C=CC=C7)O.[Cl-]
Biological Activity: Cyanine7.5 carboxylic acid chloride is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) with carboxylic acid functional groups. Cy7.5 is a near-infrared fluorescent dye commonly used in biomedical research areas such as biomarkers and cell imaging. Cyanine7.5 carboxylic acid chloride can be covalently bound to some biological molecules (especially antibodies, proteins, etc.) to track their location and dynamic changes in biological samples.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyanine7.5 carboxylic acid chloride | Cyanine7.5 carboxylic acid chloride is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) with carboxylic acid functional groups. Cy7.5 is a near-infrared fluorescent dye commonly used in biomedical research areas such as biomarkers and cell imaging. Cyanine7.5 carboxylic acid chloride can be covalently bound to some biological molecules (especially antibodies, proteins, etc.) to track their location and dynamic changes in biological samples. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
