18069-14-2
Chemical Structure
Polypodine B
Synonym(s): 5β-Hydroxyecdysterone
- CAS No.: 18069-14-2
- Formula:C27H44O8
- Molecular Weight:496.63
IUPAC Name: (2S,3R,5S,9R,10R,13R,14S,17S)-2,3,5,14-tetrahydroxy-10,13-dimethyl-17-((2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one
InChIKey: GMFLGNRCCFYOKL-ACCCYTKYSA-N
SMILES: O[C@]([C@@]1(CC2)C)(CC[C@]1([H])[C@@](C)(O)[C@H](O)CCC(C)(O)C)C([C@@]2([H])[C@]([C@]3(C[C@H]4O)O)(C[C@@H]4O)C)=CC3=O
Biological Activity: Polypodine B is a natural ecdysone ester isolated from the bark of Dacrydium intermedium. Polypodine B significantly inhibits the activity of Acanthamoeba castellani. Polypodine B has moderate antifungal activity. Polypodine B can be used for research on parasitic diseases and fungal infections[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Polypodine B | 98.60% | Polypodine B is a natural ecdysone ester isolated from the bark of Dacrydium intermedium. Polypodine B significantly inhibits the activity of Acanthamoeba castellani. Polypodine B has moderate antifungal activity. Polypodine B can be used for research on parasitic diseases and fungal infections. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
