1821464-55-4
Chemical Structure
Azide-PEG12-alcohol
- CAS No.: 1821464-55-4
- Formula:C24H49N3O12
- Molecular Weight:571.66
IUPAC Name: 35-azido-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontan-1-ol
InChIKey: AFUKFRGNHZRMCW-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO
Biological Activity: Azide-PEG12-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG12-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azide-PEG12-alcohol | 99.81% | Azide-PEG12-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azide-PEG12-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||