1835759-71-1
Chemical Structure
Azido-PEG4-(CH2)3-methyl ester
- CAS No.: 1835759-71-1
- Formula:C13H25N3O6
- Molecular Weight:319.35
IUPAC Name: methyl 1-azido-3,6,9,12-tetraoxahexadecan-16-oate
InChIKey: PZVGELSZWFBVCY-UHFFFAOYSA-N
SMILES: O=C(OC)CCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG4-(CH2)3-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG4-(CH2)3-methyl ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG4-(CH2)3-methyl ester | Azido-PEG4-(CH2)3-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG4-(CH2)3-methyl ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
