1866-15-5
Chemical Structure
Acetylthiocholine iodide
Synonym(s): S-Acetylthiocholine iodide; ATCh iodide
- CAS No.: 1866-15-5
- Formula:C7H16INOS
- Molecular Weight:289.18
IUPAC Name: 2-(acetylthio)-N,N,N-trimethylethan-1-aminium iodide
InChIKey: NTBLZMAMTZXLBP-UHFFFAOYSA-M
SMILES: O=C(SCC[N+](C)(C)C)C.[I-]
Biological Activity: Acetylthiocholine iodide can be used as a substrate for certain enzymes, such as cholinesterase, etc., and can be used to determine the activity level of these enzymes. In addition, the compound is used in some medical research, for example in the fields of neuroscience and organ physiology.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Acetylthiocholine iodide | 99.87% | Acetylthiocholine iodide can be used as a substrate for certain enzymes, such as cholinesterase, etc., and can be used to determine the activity level of these enzymes. In addition, the compound is used in some medical research, for example in the fields of neuroscience and organ physiology. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||