1955527-41-9
Chemical Structure
Sulfo-Cy5.5 Azide
- CAS No.: 1955527-41-9
- Formula:C44H50N6O13S4
- Molecular Weight:999.16
IUPAC Name: 3-(6-((3-azidopropyl)amino)-6-oxohexyl)-2-((1E,3E,5E)-5-(3-ethyl-1,1-dimethyl-6,8-disulfo-1,3-dihydro-2H-benzo[e]indol-2-ylidene)penta-1,3-dien-1-yl)-1,1-dimethyl-6-sulfo-1H-benzo[e]indol-3-ium-8-sulfonate
InChIKey: BQFSLMCVGRFHSA-UHFFFAOYSA-N
SMILES: O=C(CCCCC[N+]1=C(/C=C/C=C/C=C2N(CC)C3=C(C/2(C)C)C(C=C(S(=O)(O)=O)C=C4S(=O)(O)=O)=C4C=C3)C(C)(C)C5=C(C=C(S(=O)([O-])=O)C=C6S(=O)(O)=O)C6=CC=C15)NCCCN=[N+]=[N-]
Biological Activity: Sulfo-Cy5.5 Azide is a click chemistry reagent containing an azide group. Sulfo-Cy5.5 Azide is also a water-soluble dye (Ex=673 nm, Em=707 nm), which designed to label sensitive molecules such as peptides, proteins and oligonucleotides. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sulfo-Cy5.5 Azide | 95.0% | Sulfo-Cy5.5 Azide is a click chemistry reagent containing an azide group. Sulfo-Cy5.5 Azide is also a water-soluble dye (Ex=673 nm, Em=707 nm), which designed to label sensitive molecules such as peptides, proteins and oligonucleotides. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
