1956294-76-0
Chemical Structure
4-Pentynoyl-Val-Ala-PAB-PNP
- CAS No.: 1956294-76-0
- Formula:C27H30N4O8
- Molecular Weight:538.55
IUPAC Name: (S)-2-((tert-butoxycarbonyl)amino)-2-(2,2,3,3-tetramethylcyclopropyl)acetic acid
InChIKey: HIHCCJAGZUJVAO-UUOWRZLLSA-N
SMILES: C#CCCC(N[C@@H](C(C)C)C(N[C@@H](C)C(NC(C=C1)=CC=C1COC(OC2=CC=C(C=C2)[N+]([O-])=O)=O)=O)=O)=O
Biological Activity: 4-Pentynoyl-Val-Ala-PAB-PNP is a cleavable ADC linker, that has been used to synthesis cryptophycin conjugates[1]. 4-Pentynoyl-Val-Ala-PAB-PNP is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Pentynoyl-Val-Ala-PAB-PNP | 4-Pentynoyl-Val-Ala-PAB-PNP is a cleavable ADC linker, that has been used to synthesis cryptophycin conjugates. 4-Pentynoyl-Val-Ala-PAB-PNP is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||