202657-61-2
Chemical Structure
VMAPRTLFL
- CAS No.: 202657-61-2
- Formula:C49H82N12O11S
- Molecular Weight:1047.31
SMILES: CC(C)[C@H](N)C(N[C@@H](CCSC)C(N[C@@H](C)C(N1[C@@H](CCC1)C(N[C@@H](CCCNC(N)=N)C(N[C@@H]([C@H](O)C)C(N[C@@H](CC(C)C)C(N[C@H](C(N[C@H](C(O)=O)CC(C)C)=O)CC2=CC=CC=C2)=O)=O)=O)=O)=O)=O)=O
Biological Activity: VMAPRTLFL is a 9-mer peptide derived from the signal peptide of HLA-G and can serve as a peptide ligand for HLA-E. VMAPRTLFL plays a crucial role in regulating the functions of adaptive natural killer (NK) cells. Specifically, VMAPRTLFL enriches FcεRγ- adaptive NK cells, upregulates the expression of CD25, and enhances their proliferative activity, antibody-dependent cellular cytotoxicity (ADCC), and IFN-γ release. VMAPRTLFL can be used in research related to human cytomegalovirus (HCMV) infection, transplant rejection, and pregnancy immunity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
VMAPRTLFL | VMAPRTLFL is a 9-mer peptide derived from the signal peptide of HLA-G and can serve as a peptide ligand for HLA-E. VMAPRTLFL plays a crucial role in regulating the functions of adaptive natural killer (NK) cells. Specifically, VMAPRTLFL enriches FcεRγ- adaptive NK cells, upregulates the expression of CD25, and enhances their proliferative activity, antibody-dependent cellular cytotoxicity (ADCC), and IFN-γ release. VMAPRTLFL can be used in research related to human cytomegalovirus (HCMV) infection, transplant rejection, and pregnancy immunity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||