2055041-24-0
Chemical Structure
Azido-PEG3-S-PEG4-propargyl
- CAS No.: 2055041-24-0
- Formula:C19H35N3O7S
- Molecular Weight:449.56
IUPAC Name: 1-azido-3,6,9,15,18,21,24-heptaoxa-12-thiaheptacos-26-yne
InChIKey: WWUGRHVDODLKCE-UHFFFAOYSA-N
SMILES: C#CCOCCOCCOCCOCCSCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG3-S-PEG4-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG3-S-PEG4-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG3-S-PEG4-propargyl | Azido-PEG3-S-PEG4-propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG3-S-PEG4-propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||