2055048-42-3
Chemical Structure
Dde Biotin-PEG4-Picolyl azide
- CAS No.: 2055048-42-3
- Formula:C38H57N9O9S
- Molecular Weight:815.98
IUPAC Name: N-(6-(azidomethyl)pyridin-3-yl)-15-(4,4-dimethyl-2,6-dioxocyclohexylidene)-1-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)-3,6,9,12-tetraoxa-16-azanonadecan-19-amide
InChIKey: CYXSXYDLWXHYSI-RHLYCORQSA-N
SMILES: O=C(NC1=CC=C(CN=[N+]=[N-])N=C1)CCN/C(CCOCCOCCOCCOCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O)=C4C(CC(C)(C)CC/4=O)=O
Biological Activity: Dde Biotin-PEG4-Picolyl azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Dde Biotin-PEG4-Picolyl azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dde Biotin-PEG4-Picolyl azide | Dde Biotin-PEG4-Picolyl azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Dde Biotin-PEG4-Picolyl azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||