2055736-28-0
Chemical Structure
PC Methyltetrazine-PEG4-NHS carbonate ester
- CAS. Nr.: 2055736-28-0
- Formula:C35H43N7O14
- Molecular Weight:785.75
IUPAC Name: 2,5-dioxopyrrolidin-1-yl (1-(5-methoxy-4-((1-(4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy)-13-oxo-3,6,9-trioxa-12-azahexadecan-16-yl)oxy)-2-nitrophenyl)ethyl) carbonate
InChIKey: FYXJZLYXHCHOII-UHFFFAOYSA-N
SMILES: O=C(OC(C1=CC(OC)=C(OCCCC(NCCOCCOCCOCCOC2=CC=C(C3=NN=C(C)N=N3)C=C2)=O)C=C1[N+]([O-])=O)C)ON4C(CCC4=O)=O
Biological Activity: PC Methyltetrazine-PEG4-NHS carbonate ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. PC Methyltetrazine-PEG4-NHS carbonate ester is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PC Methyltetrazine-PEG4-NHS carbonate ester | PC Methyltetrazine-PEG4-NHS carbonate ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. PC Methyltetrazine-PEG4-NHS carbonate ester is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
