208106-53-0
Chemical Structure
Shanciol B
- CAS No.: 208106-53-0
- Formula:C25H26O6
- Molecular Weight:422.47
IUPAC Name: (2R,3S)-2-(4-hydroxy-3-methoxyphenyl)-5-(3-hydroxyphenethyl)-7-methoxychroman-3-ol
InChIKey: ROBJEENLSUOGLU-WIOPSUGQSA-N
SMILES: OC1=CC=CC(CCC2=C3C(O[C@H](C4=CC(OC)=C(C=C4)O)[C@H](C3)O)=CC(OC)=C2)=C1
Biological Activity: Shanciol B, isolated from the ethyl acetate extract of the air-dried whole plant of Pholidota imbricate Hook, inhibits nitric oxide (NO) production and 1,1-diphenyl-2-picrylhydrazil (DPPH) radical scavenging activity[1]. Shanciol B is a microsomal prostaglandin E synthase-1 (mPGES-1) inhibitor with anti-inflammatory activity[2].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Shanciol B | Shanciol B, isolated from the ethyl acetate extract of the air-dried whole plant of Pholidota imbricate Hook, inhibits nitric oxide (NO) production and 1,1-diphenyl-2-picrylhydrazil (DPPH) radical scavenging activity. Shanciol B is a microsomal prostaglandin E synthase-1 (mPGES-1) inhibitor with anti-inflammatory activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords