208834-81-5
Chemical Structure
Stenophyllol B
- CAS No.: 208834-81-5
- Formula:C42H32O9
- Molecular Weight:680.70
InChIKey: UXHSAOFTHSNXMK-RHTQMFJXSA-N
SMILES: OC1=CC(O[C@H]2C3=CC=C(C=C3)O)=C4[C@@]2([H])C5=CC(O)=CC(O)=C5[C@@H](C6=CC=C(C=C6)O)[C@@](C7=CC(O)=CC(O)=C7[C@@H]8C9=CC=C(C=C9)O)([H])[C@]8([H])C4=C1
Biological Activity: Stenophyllol B (compound 4) is a trimeric stilbene with bicyclic and bridged tricyclic skeletons. Stenophyllol B was first discovered in the dipterocarps plant and has been found in many species of Hopea, Neobalanocarpus, Shorea, Stemonoporus and Vateri[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Stenophyllol B | Stenophyllol B (compound 4) is a trimeric stilbene with bicyclic and bridged tricyclic skeletons. Stenophyllol B was first discovered in the dipterocarps plant and has been found in many species of Hopea, Neobalanocarpus, Shorea, Stemonoporus and Vateri. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords