2093153-95-6
Chemical Structure
N-(Azido-PEG2)-N-Boc-PEG4-NHS ester
- CAS No.: 2093153-95-6
- Formula:C26H45N5O12
- Molecular Weight:619.66
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 1-azido-9-(tert-butoxycarbonyl)-3,6,12,15,18,21-hexaoxa-9-azatetracosan-24-oate
InChIKey: JLYRAESBBJMWBK-UHFFFAOYSA-N
SMILES: O=C(OC(C)(C)C)N(CCOCCOCCN=[N+]=[N-])CCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
Biological Activity: N-(Azido-PEG2)-N-Boc-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Azido-PEG2)-N-Boc-PEG4-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(Azido-PEG2)-N-Boc-PEG4-NHS ester | N-(Azido-PEG2)-N-Boc-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-(Azido-PEG2)-N-Boc-PEG4-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||