2100893-80-7
Chemical Structure
8-(9-Bromoanthracene)-BODIPY 505/515
- CAS No.: 2100893-80-7
- Formula:C27H22BBrF2N2
- Molecular Weight:503.19
InChIKey: UJEWRXAMBDBEQD-UHFFFAOYSA-N
SMILES: CC1=CC(C)=[N]2[B+3]([F-])([F-])[N-]3C(C)=CC(C)=C3C(C4=C5C=CC=CC5=C(Br)C6=C4C=CC=C6)=C12
Biological Activity: 8-(9-Bromoanthracene)-BODIPY 505/515 is a fluorescence turn-on probe with selective fluorescence turn-on response towards hydroxyl radical. 8-(9-Bromoanthracene)-BODIPY 505/515 can be used to detect reactive oxygen/nitrogen species (ROS/RNS)[1]. (Ex/Em = 505/515 nm)
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8-(9-Bromoanthracene)-BODIPY 505/515 | 8-(9-Bromoanthracene)-BODIPY 505/515 is a fluorescence turn-on probe with selective fluorescence turn-on response towards hydroxyl radical. 8-(9-Bromoanthracene)-BODIPY 505/515 can be used to detect reactive oxygen/nitrogen species (ROS/RNS). (Ex/Em = 505/515 nm) | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||