2107273-00-5
Chemical Structure
N-(Ac-PEG3)-N'-(azide-PEG3)-Cy7 chloride
- CAS No.: 2107273-00-5
- Formula:C43H58ClN5O7
- Molecular Weight:792.40
IUPAC Name: 1-(2-(2-(2-acetoxyethoxy)ethoxy)ethyl)-2-((1E,3E,5E)-7-((E)-1-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)-3,3-dimethylindolin-2-ylidene)hepta-1,3,5-trien-1-yl)-3,3-dimethyl-3H-indol-1-ium chloride
InChIKey: HVDWUPHUQBHZMT-UHFFFAOYSA-M
SMILES: CC1(C)C(/C=C/C=C/C=C/C=C2N(CCOCCOCCOCCN=[N+]=[N-])C3=C(C=CC=C3)C/2(C)C)=[N+](CCOCCOCCOC(C)=O)C4=C1C=CC=C4.[Cl-]
Biological Activity: N-(Ac-PEG3)-N'-(azide-PEG3)-Cy7 (chloride) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Ac-PEG3)-N'-(azide-PEG3)-Cy7 (chloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(Ac-PEG3)-N'-(azide-PEG3)-Cy7 chloride | N-(Ac-PEG3)-N'-(azide-PEG3)-Cy7 (chloride) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-(Ac-PEG3)-N'-(azide-PEG3)-Cy7 (chloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
