2107273-16-3
Chemical Structure
N-methyl-N'-(azide-PEG3)-Cy3
- CAS No.: 2107273-16-3
- Formula:C32H42ClN5O3
- Molecular Weight:580.16
IUPAC Name: 1-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)-3,3-dimethyl-2-((E)-3-((E)-1,3,3-trimethylindolin-2-ylidene)prop-1-en-1-yl)-3H-indol-1-ium chloride
InChIKey: SGXCJGKDAXLWKL-UHFFFAOYSA-M
SMILES: CC(C1=C(N/2C)C=CC=C1)(C)C2=C/C=C/C3=[N+](CCOCCOCCOCCN=[N+]=[N-])C4=C(C=CC=C4)C3(C)C.[Cl-]
Biological Activity: N-methyl-N'-(azide-PEG3)-Cy3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-methyl-N'-(azide-PEG3)-Cy3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-methyl-N'-(azide-PEG3)-Cy3 | N-methyl-N'-(azide-PEG3)-Cy3 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-methyl-N'-(azide-PEG3)-Cy3 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
