2170240-91-0
Chemical Structure
Azido-PEG3-aminoacetic acid-NHS ester
- CAS No.: 2170240-91-0
- Formula:C14H23N5O7
- Molecular Weight:373.36
IUPAC Name: 2,5-dioxopyrrolidin-1-yl (2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)glycinate
InChIKey: LLFDDJSHNLEEBA-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CNCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG3-aminoacetic acid-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG3-aminoacetic acid-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG3-aminoacetic acid-NHS ester | Azido-PEG3-aminoacetic acid-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG3-aminoacetic acid-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||