217180-81-9
Chemical Structure
Azido-PEG5-CH2CO2H
- CAS No.: 217180-81-9
- Formula:C12H23N3O7
- Molecular Weight:321.33
IUPAC Name: 17-azido-3,6,9,12,15-pentaoxaheptadecanoic acid
InChIKey: CEACGPKHPWXRQF-UHFFFAOYSA-N
SMILES: O=C(O)COCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG5-CH2CO2H is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG5-CH2CO2H is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG5-CH2CO2H is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG5-CH2CO2H | 98.88% | Azido-PEG5-CH2CO2H is a cleavable 5 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azido-PEG5-CH2CO2H is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG5-CH2CO2H is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
