22419-74-5
Chemical Structure
Incensole
- CAS No.: 22419-74-5
- Formula:C20H34O2
- Molecular Weight:306.48
IUPAC Name: (1R,2S,5E,9E,12S)-12-isopropyl-1,5,9-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol
InChIKey: SSBZLMMXFQMHDP-REDNKFHQSA-N
SMILES: O[C@@H]1[C@@](O2)(C)CC[C@@]2(C(C)C)C/C=C(C)/CC/C=C(C)/CC1
Biological Activity: Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Incensole | 98.12% | Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Incensole (Standard) | ≥98% | Incensole (Standard) is the analytical standard of Incensole. This product is intended for research and analytical applications. Incensole, a 14-membered diterpenoid, is isolated from both essential oils and resins of frankincense. Incensole has shown anti-inflammatory and anti-depression activities due to their ability to activate ion channels in the brain to alleviate anxiety or depression. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords