2242753-66-6
Chemical Structure
PRMT5-IN-28
- CAS No.: 2242753-66-6
- Formula:C18H19ClN4O5
- Molecular Weight:406.82
IUPAC Name: (Z)-7-((2R,3R,4S,5R)-5-((R)-(4-chlorophenyl)(hydroxy)methyl)-3,4-dihydroxytetrahydrofuran-2-yl)-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one O-methyl oxime
InChIKey: AMEIDIZPVPXFLE-KQVLKZGSSA-N
SMILES: O[C@H]([C@@H]1O)[C@@H](O[C@]1([H])[C@@H](C(C=C2)=CC=C2Cl)O)N3C(NC=N/C4=N\OC)=C4C=C3
Biological Activity: PRMT5-IN-28 (compound 36) is an inhibitor of protein arginine methyltransferase 5 (PRMT5) enzyme. Protein arginine methylation is a common post-translational modification involved in gene transcription, mRNA splicing, DNA repair, protein cellular localization, cell fate determination and signal transduction, etc. Abnormal PRMT5 can promote cancer cell proliferation, resist apoptosis, enhance invasion and metastasis, and affect immune escape[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PRMT5-IN-28 | PRMT5-IN-28 (compound 36) is an inhibitor of protein arginine methyltransferase 5 (PRMT5) enzyme. Protein arginine methylation is a common post-translational modification involved in gene transcription, mRNA splicing, DNA repair, protein cellular localization, cell fate determination and signal transduction, etc. Abnormal PRMT5 can promote cancer cell proliferation, resist apoptosis, enhance invasion and metastasis, and affect immune escape. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
