2243566-44-9
Chemical Structure
Azidoethyl-SS-propionic NHS ester
- CAS No.: 2243566-44-9
- Formula:C9H12N4O4S2
- Molecular Weight:304.35
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 3-((2-azidoethyl)disulfanyl)propanoate
InChIKey: KEOGJOSSYXNLNK-UHFFFAOYSA-N
SMILES: O=C(ON1C(CCC1=O)=O)CCSSCCN=[N+]=[N-]
Biological Activity: Azidoethyl-SS-propionic NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azidoethyl-SS-propionic NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azidoethyl-SS-propionic NHS ester | Azidoethyl-SS-propionic NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Azidoethyl-SS-propionic NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||