2250433-81-7
Chemical Structure
Fmoc-Abg(N3)-OH
- CAS No.: 2250433-81-7
- Formula:C21H22N4O4
- Molecular Weight:394.42
IUPAC Name: N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(4-azidobutyl)glycine
InChIKey: BCWAOXCPEFZRDL-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCCCN(CC(O)=O)C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O
Biological Activity: Fmoc-Abg(N3)-OH is a click chemistry reagent containing an azide group. Fmoc-Abg(N3)-OH has the potential to synthesize peptide nucleic acids (PNA) and peptoids. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Fmoc-Abg(N3)-OH | Fmoc-Abg(N3)-OH is a click chemistry reagent containing an azide group. Fmoc-Abg(N3)-OH has the potential to synthesize peptide nucleic acids (PNA) and peptoids. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||